About (2R,6R)-2-(chloromethyl)-3,6-dihydro-2H-pyran-6-ol
(2R,6R)-2-(chloromethyl)-3,6-dihydro-2H-pyran-6-ol (PubChem CID 55298588) has the molecular formula C6H9ClO2
and a molecular weight of 148.59 g/mol. Its IUPAC name is (2R,6R)-2-(chloromethyl)-3,6-dihydro-2H-pyran-6-ol.
Molecular Properties
| Compound Name | (2R,6R)-2-(chloromethyl)-3,6-dihydro-2H-pyran-6-ol |
| PubChem CID | 55298588 |
| Molecular Formula | C6H9ClO2 |
| Molecular Weight | 148.59 g/mol |
| Exact Mass | 148.03 |
| IUPAC Name | (2R,6R)-2-(chloromethyl)-3,6-dihydro-2H-pyran-6-ol |
| SMILES | O[C@H]1C=CC[C@H](CCl)O1 |
| InChI | InChI=1S/C6H9ClO2/c7-4-5-2-1-3-6(8)9-5/h1,3,5-6,8H,2,4H2/t5-,6-/m1/s1 |
| InChIKey | MBHMTZKBEIYYJG-PHDIDXHHSA-N |
| XLogP | 0.89 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.59 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R,6R)-2-(chloromethyl)-3,6-dihydro-2H-pyran-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,6R)-2-(chloromethyl)-3,6-dihydro-2H-pyran-6-ol?
The IUPAC name of (2R,6R)-2-(chloromethyl)-3,6-dihydro-2H-pyran-6-ol (CID 55298588) is (2R,6R)-2-(chloromethyl)-3,6-dihydro-2H-pyran-6-ol.
What is the SMILES notation for (2R,6R)-2-(chloromethyl)-3,6-dihydro-2H-pyran-6-ol?
The canonical SMILES for (2R,6R)-2-(chloromethyl)-3,6-dihydro-2H-pyran-6-ol is O[C@H]1C=CC[C@H](CCl)O1.
What is the InChIKey of (2R,6R)-2-(chloromethyl)-3,6-dihydro-2H-pyran-6-ol?
The InChIKey is MBHMTZKBEIYYJG-PHDIDXHHSA-N. The full InChI is InChI=1S/C6H9ClO2/c7-4-5-2-1-3-6(8)9-5/h1,3,5-6,8H,2,4H2/t5-,6-/m1/s1.
What are the key properties of (2R,6R)-2-(chloromethyl)-3,6-dihydro-2H-pyran-6-ol?
(2R,6R)-2-(chloromethyl)-3,6-dihydro-2H-pyran-6-ol has a molecular weight of 148.59 g/mol, XLogP of 0.89, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,6R)-2-(chloromethyl)-3,6-dihydro-2H-pyran-6-ol is sourced from PubChem (CID 55298588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).