About (3S,4S)-3,4-bis(ethenyl)azetidin-2-one
(3S,4S)-3,4-bis(ethenyl)azetidin-2-one (PubChem CID 55298762) has the molecular formula C7H9NO
and a molecular weight of 123.15 g/mol. Its IUPAC name is (3S,4S)-3,4-bis(ethenyl)azetidin-2-one.
Molecular Properties
| Compound Name | (3S,4S)-3,4-bis(ethenyl)azetidin-2-one |
| PubChem CID | 55298762 |
| Molecular Formula | C7H9NO |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.07 |
| IUPAC Name | (3S,4S)-3,4-bis(ethenyl)azetidin-2-one |
| SMILES | C=C[C@@H]1NC(=O)[C@H]1C=C |
| InChI | InChI=1S/C7H9NO/c1-3-5-6(4-2)8-7(5)9/h3-6H,1-2H2,(H,8,9)/t5-,6-/m0/s1 |
| InChIKey | PSAQVUMNLVMHIN-WDSKDSINSA-N |
| XLogP | 0.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3S,4S)-3,4-bis(ethenyl)azetidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-3,4-bis(ethenyl)azetidin-2-one?
The IUPAC name of (3S,4S)-3,4-bis(ethenyl)azetidin-2-one (CID 55298762) is (3S,4S)-3,4-bis(ethenyl)azetidin-2-one.
What is the SMILES notation for (3S,4S)-3,4-bis(ethenyl)azetidin-2-one?
The canonical SMILES for (3S,4S)-3,4-bis(ethenyl)azetidin-2-one is C=C[C@@H]1NC(=O)[C@H]1C=C.
What is the InChIKey of (3S,4S)-3,4-bis(ethenyl)azetidin-2-one?
The InChIKey is PSAQVUMNLVMHIN-WDSKDSINSA-N. The full InChI is InChI=1S/C7H9NO/c1-3-5-6(4-2)8-7(5)9/h3-6H,1-2H2,(H,8,9)/t5-,6-/m0/s1.
What are the key properties of (3S,4S)-3,4-bis(ethenyl)azetidin-2-one?
(3S,4S)-3,4-bis(ethenyl)azetidin-2-one has a molecular weight of 123.15 g/mol, XLogP of 0.47, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-3,4-bis(ethenyl)azetidin-2-one is sourced from PubChem (CID 55298762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).