About 2-thiocyanatopropanoic acid
2-thiocyanatopropanoic acid (PubChem CID 55298788) has the molecular formula C4H5NO2S
and a molecular weight of 131.16 g/mol. Its IUPAC name is 2-thiocyanatopropanoic acid.
Molecular Properties
| Compound Name | 2-thiocyanatopropanoic acid |
| PubChem CID | 55298788 |
| Molecular Formula | C4H5NO2S |
| Molecular Weight | 131.16 g/mol |
| Exact Mass | 131.00 |
| IUPAC Name | 2-thiocyanatopropanoic acid |
| SMILES | CC(SC#N)C(=O)O |
| InChI | InChI=1S/C4H5NO2S/c1-3(4(6)7)8-2-5/h3H,1H3,(H,6,7) |
| InChIKey | QJZIGRDRTMUAAV-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.16 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-thiocyanatopropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-thiocyanatopropanoic acid?
The IUPAC name of 2-thiocyanatopropanoic acid (CID 55298788) is 2-thiocyanatopropanoic acid.
What is the SMILES notation for 2-thiocyanatopropanoic acid?
The canonical SMILES for 2-thiocyanatopropanoic acid is CC(SC#N)C(=O)O.
What is the InChIKey of 2-thiocyanatopropanoic acid?
The InChIKey is QJZIGRDRTMUAAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO2S/c1-3(4(6)7)8-2-5/h3H,1H3,(H,6,7).
What are the key properties of 2-thiocyanatopropanoic acid?
2-thiocyanatopropanoic acid has a molecular weight of 131.16 g/mol, XLogP of 0.67, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-thiocyanatopropanoic acid is sourced from PubChem (CID 55298788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).