About N-[(1E)-3-methylbuta-1,3-dienyl]propanamide
N-[(1E)-3-methylbuta-1,3-dienyl]propanamide (PubChem CID 55298868) has the molecular formula C8H13NO
and a molecular weight of 139.20 g/mol. Its IUPAC name is N-[(1E)-3-methylbuta-1,3-dienyl]propanamide.
Molecular Properties
| Compound Name | N-[(1E)-3-methylbuta-1,3-dienyl]propanamide |
| PubChem CID | 55298868 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | N-[(1E)-3-methylbuta-1,3-dienyl]propanamide |
| SMILES | C=C(C)/C=C/NC(=O)CC |
| InChI | InChI=1S/C8H13NO/c1-4-8(10)9-6-5-7(2)3/h5-6H,2,4H2,1,3H3,(H,9,10)/b6-5+ |
| InChIKey | AQSLFKMTNWMQFB-AATRIKPKSA-N |
| XLogP | 1.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1E)-3-methylbuta-1,3-dienyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1E)-3-methylbuta-1,3-dienyl]propanamide?
The IUPAC name of N-[(1E)-3-methylbuta-1,3-dienyl]propanamide (CID 55298868) is N-[(1E)-3-methylbuta-1,3-dienyl]propanamide.
What is the SMILES notation for N-[(1E)-3-methylbuta-1,3-dienyl]propanamide?
The canonical SMILES for N-[(1E)-3-methylbuta-1,3-dienyl]propanamide is C=C(C)/C=C/NC(=O)CC.
What is the InChIKey of N-[(1E)-3-methylbuta-1,3-dienyl]propanamide?
The InChIKey is AQSLFKMTNWMQFB-AATRIKPKSA-N. The full InChI is InChI=1S/C8H13NO/c1-4-8(10)9-6-5-7(2)3/h5-6H,2,4H2,1,3H3,(H,9,10)/b6-5+.
What are the key properties of N-[(1E)-3-methylbuta-1,3-dienyl]propanamide?
N-[(1E)-3-methylbuta-1,3-dienyl]propanamide has a molecular weight of 139.20 g/mol, XLogP of 1.60, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1E)-3-methylbuta-1,3-dienyl]propanamide is sourced from PubChem (CID 55298868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).