C7H13N3 — CID 55299006
1,4,7-triazatricyclo[5.2.1.02,6]decane (PubChem CID 55299006) has the molecular formula C7H13N3 and a molecular weight of 139.20 g/mol. Its IUPAC name is 1,4,7-triazatricyclo[5.2.1.02,6]decane.
| Compound Name | 1,4,7-triazatricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 55299006 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | 1,4,7-triazatricyclo[5.2.1.02,6]decane |
| SMILES | C1NCC2C1N1CCN2C1 |
| InChI | InChI=1S/C7H13N3/c1-2-10-5-9(1)6-3-8-4-7(6)10/h6-8H,1-5H2 |
| InChIKey | FVZIHKBWDQPHRB-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |