About (1S,4S)-2λ6-thia-5-azabicyclo[2.2.1]heptane 2,2-dioxide
(1S,4S)-2λ6-thia-5-azabicyclo[2.2.1]heptane 2,2-dioxide (PubChem CID 55299066) has the molecular formula C5H9NO2S
and a molecular weight of 147.20 g/mol. Its IUPAC name is (1S,4S)-2λ6-thia-5-azabicyclo[2.2.1]heptane 2,2-dioxide.
Molecular Properties
| Compound Name | (1S,4S)-2λ6-thia-5-azabicyclo[2.2.1]heptane 2,2-dioxide |
| PubChem CID | 55299066 |
| Molecular Formula | C5H9NO2S |
| Molecular Weight | 147.20 g/mol |
| Exact Mass | 147.04 |
| IUPAC Name | (1S,4S)-2λ6-thia-5-azabicyclo[2.2.1]heptane 2,2-dioxide |
| SMILES | O=S1(=O)C[C@@H]2C[C@H]1CN2 |
| InChI | InChI=1S/C5H9NO2S/c7-9(8)3-4-1-5(9)2-6-4/h4-6H,1-3H2/t4-,5-/m0/s1 |
| InChIKey | REPYGHXGZNDHNU-WHFBIAKZSA-N |
| XLogP | -0.85 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.20 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1S,4S)-2λ6-thia-5-azabicyclo[2.2.1]heptane 2,2-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,4S)-2λ6-thia-5-azabicyclo[2.2.1]heptane 2,2-dioxide?
The IUPAC name of (1S,4S)-2λ6-thia-5-azabicyclo[2.2.1]heptane 2,2-dioxide (CID 55299066) is (1S,4S)-2λ6-thia-5-azabicyclo[2.2.1]heptane 2,2-dioxide.
What is the SMILES notation for (1S,4S)-2λ6-thia-5-azabicyclo[2.2.1]heptane 2,2-dioxide?
The canonical SMILES for (1S,4S)-2λ6-thia-5-azabicyclo[2.2.1]heptane 2,2-dioxide is O=S1(=O)C[C@@H]2C[C@H]1CN2.
What is the InChIKey of (1S,4S)-2λ6-thia-5-azabicyclo[2.2.1]heptane 2,2-dioxide?
The InChIKey is REPYGHXGZNDHNU-WHFBIAKZSA-N. The full InChI is InChI=1S/C5H9NO2S/c7-9(8)3-4-1-5(9)2-6-4/h4-6H,1-3H2/t4-,5-/m0/s1.
What are the key properties of (1S,4S)-2λ6-thia-5-azabicyclo[2.2.1]heptane 2,2-dioxide?
(1S,4S)-2λ6-thia-5-azabicyclo[2.2.1]heptane 2,2-dioxide has a molecular weight of 147.20 g/mol, XLogP of -0.85, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,4S)-2λ6-thia-5-azabicyclo[2.2.1]heptane 2,2-dioxide is sourced from PubChem (CID 55299066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).