About (2S)-4-fluoro-2-methyl-1,2-dihydropyrrol-5-one
(2S)-4-fluoro-2-methyl-1,2-dihydropyrrol-5-one (PubChem CID 55299268) has the molecular formula C5H6FNO
and a molecular weight of 115.11 g/mol. Its IUPAC name is (2S)-4-fluoro-2-methyl-1,2-dihydropyrrol-5-one.
Molecular Properties
| Compound Name | (2S)-4-fluoro-2-methyl-1,2-dihydropyrrol-5-one |
| PubChem CID | 55299268 |
| Molecular Formula | C5H6FNO |
| Molecular Weight | 115.11 g/mol |
| Exact Mass | 115.04 |
| IUPAC Name | (2S)-4-fluoro-2-methyl-1,2-dihydropyrrol-5-one |
| SMILES | C[C@H]1C=C(F)C(=O)N1 |
| InChI | InChI=1S/C5H6FNO/c1-3-2-4(6)5(8)7-3/h2-3H,1H3,(H,7,8)/t3-/m0/s1 |
| InChIKey | VDJUILOYOYKMIA-VKHMYHEASA-N |
| XLogP | 0.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.11 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S)-4-fluoro-2-methyl-1,2-dihydropyrrol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4-fluoro-2-methyl-1,2-dihydropyrrol-5-one?
The IUPAC name of (2S)-4-fluoro-2-methyl-1,2-dihydropyrrol-5-one (CID 55299268) is (2S)-4-fluoro-2-methyl-1,2-dihydropyrrol-5-one.
What is the SMILES notation for (2S)-4-fluoro-2-methyl-1,2-dihydropyrrol-5-one?
The canonical SMILES for (2S)-4-fluoro-2-methyl-1,2-dihydropyrrol-5-one is C[C@H]1C=C(F)C(=O)N1.
What is the InChIKey of (2S)-4-fluoro-2-methyl-1,2-dihydropyrrol-5-one?
The InChIKey is VDJUILOYOYKMIA-VKHMYHEASA-N. The full InChI is InChI=1S/C5H6FNO/c1-3-2-4(6)5(8)7-3/h2-3H,1H3,(H,7,8)/t3-/m0/s1.
What are the key properties of (2S)-4-fluoro-2-methyl-1,2-dihydropyrrol-5-one?
(2S)-4-fluoro-2-methyl-1,2-dihydropyrrol-5-one has a molecular weight of 115.11 g/mol, XLogP of 0.36, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-fluoro-2-methyl-1,2-dihydropyrrol-5-one is sourced from PubChem (CID 55299268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).