About [2,4-bis(ethenyl)cyclopentyl]-trimethylsilane
[2,4-bis(ethenyl)cyclopentyl]-trimethylsilane (PubChem CID 552993) has the molecular formula C12H22Si
and a molecular weight of 194.39 g/mol. Its IUPAC name is [2,4-bis(ethenyl)cyclopentyl]-trimethylsilane.
Molecular Properties
| Compound Name | [2,4-bis(ethenyl)cyclopentyl]-trimethylsilane |
| PubChem CID | 552993 |
| Molecular Formula | C12H22Si |
| Molecular Weight | 194.39 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | [2,4-bis(ethenyl)cyclopentyl]-trimethylsilane |
| SMILES | C=CC1CC(C=C)C([Si](C)(C)C)C1 |
| InChI | InChI=1S/C12H22Si/c1-6-10-8-11(7-2)12(9-10)13(3,4)5/h6-7,10-12H,1-2,8-9H2,3-5H3 |
| InChIKey | WYMYSRXKAPYGMB-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [2,4-bis(ethenyl)cyclopentyl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,4-bis(ethenyl)cyclopentyl]-trimethylsilane?
The IUPAC name of [2,4-bis(ethenyl)cyclopentyl]-trimethylsilane (CID 552993) is [2,4-bis(ethenyl)cyclopentyl]-trimethylsilane.
What is the SMILES notation for [2,4-bis(ethenyl)cyclopentyl]-trimethylsilane?
The canonical SMILES for [2,4-bis(ethenyl)cyclopentyl]-trimethylsilane is C=CC1CC(C=C)C([Si](C)(C)C)C1.
What is the InChIKey of [2,4-bis(ethenyl)cyclopentyl]-trimethylsilane?
The InChIKey is WYMYSRXKAPYGMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22Si/c1-6-10-8-11(7-2)12(9-10)13(3,4)5/h6-7,10-12H,1-2,8-9H2,3-5H3.
What are the key properties of [2,4-bis(ethenyl)cyclopentyl]-trimethylsilane?
[2,4-bis(ethenyl)cyclopentyl]-trimethylsilane has a molecular weight of 194.39 g/mol, XLogP of 4.09, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [2,4-bis(ethenyl)cyclopentyl]-trimethylsilane is sourced from PubChem (CID 552993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).