About (2S)-2-propyl-2,5-dihydro-1H-pyridin-6-one
(2S)-2-propyl-2,5-dihydro-1H-pyridin-6-one (PubChem CID 55299327) has the molecular formula C8H13NO
and a molecular weight of 139.20 g/mol. Its IUPAC name is (2S)-2-propyl-2,5-dihydro-1H-pyridin-6-one.
Molecular Properties
| Compound Name | (2S)-2-propyl-2,5-dihydro-1H-pyridin-6-one |
| PubChem CID | 55299327 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | (2S)-2-propyl-2,5-dihydro-1H-pyridin-6-one |
| SMILES | CCC[C@H]1C=CCC(=O)N1 |
| InChI | InChI=1S/C8H13NO/c1-2-4-7-5-3-6-8(10)9-7/h3,5,7H,2,4,6H2,1H3,(H,9,10)/t7-/m0/s1 |
| InChIKey | WHRTUXJQEZAQGH-ZETCQYMHSA-N |
| XLogP | 1.23 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-propyl-2,5-dihydro-1H-pyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-propyl-2,5-dihydro-1H-pyridin-6-one?
The IUPAC name of (2S)-2-propyl-2,5-dihydro-1H-pyridin-6-one (CID 55299327) is (2S)-2-propyl-2,5-dihydro-1H-pyridin-6-one.
What is the SMILES notation for (2S)-2-propyl-2,5-dihydro-1H-pyridin-6-one?
The canonical SMILES for (2S)-2-propyl-2,5-dihydro-1H-pyridin-6-one is CCC[C@H]1C=CCC(=O)N1.
What is the InChIKey of (2S)-2-propyl-2,5-dihydro-1H-pyridin-6-one?
The InChIKey is WHRTUXJQEZAQGH-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H13NO/c1-2-4-7-5-3-6-8(10)9-7/h3,5,7H,2,4,6H2,1H3,(H,9,10)/t7-/m0/s1.
What are the key properties of (2S)-2-propyl-2,5-dihydro-1H-pyridin-6-one?
(2S)-2-propyl-2,5-dihydro-1H-pyridin-6-one has a molecular weight of 139.20 g/mol, XLogP of 1.23, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-propyl-2,5-dihydro-1H-pyridin-6-one is sourced from PubChem (CID 55299327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).