About N-[(2S)-butan-2-yl]-3,4-dihydro-2H-pyrrol-5-amine
N-[(2S)-butan-2-yl]-3,4-dihydro-2H-pyrrol-5-amine (PubChem CID 55299481) has the molecular formula C8H16N2
and a molecular weight of 140.23 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-3,4-dihydro-2H-pyrrol-5-amine.
Molecular Properties
| Compound Name | N-[(2S)-butan-2-yl]-3,4-dihydro-2H-pyrrol-5-amine |
| PubChem CID | 55299481 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | N-[(2S)-butan-2-yl]-3,4-dihydro-2H-pyrrol-5-amine |
| SMILES | CC[C@H](C)NC1=NCCC1 |
| InChI | InChI=1S/C8H16N2/c1-3-7(2)10-8-5-4-6-9-8/h7H,3-6H2,1-2H3,(H,9,10)/t7-/m0/s1 |
| InChIKey | XIUHVULMIQFABB-ZETCQYMHSA-N |
| XLogP | 1.57 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(2S)-butan-2-yl]-3,4-dihydro-2H-pyrrol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S)-butan-2-yl]-3,4-dihydro-2H-pyrrol-5-amine?
The IUPAC name of N-[(2S)-butan-2-yl]-3,4-dihydro-2H-pyrrol-5-amine (CID 55299481) is N-[(2S)-butan-2-yl]-3,4-dihydro-2H-pyrrol-5-amine.
What is the SMILES notation for N-[(2S)-butan-2-yl]-3,4-dihydro-2H-pyrrol-5-amine?
The canonical SMILES for N-[(2S)-butan-2-yl]-3,4-dihydro-2H-pyrrol-5-amine is CC[C@H](C)NC1=NCCC1.
What is the InChIKey of N-[(2S)-butan-2-yl]-3,4-dihydro-2H-pyrrol-5-amine?
The InChIKey is XIUHVULMIQFABB-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H16N2/c1-3-7(2)10-8-5-4-6-9-8/h7H,3-6H2,1-2H3,(H,9,10)/t7-/m0/s1.
What are the key properties of N-[(2S)-butan-2-yl]-3,4-dihydro-2H-pyrrol-5-amine?
N-[(2S)-butan-2-yl]-3,4-dihydro-2H-pyrrol-5-amine has a molecular weight of 140.23 g/mol, XLogP of 1.57, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S)-butan-2-yl]-3,4-dihydro-2H-pyrrol-5-amine is sourced from PubChem (CID 55299481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).