About 4-methylcyclohexa-1,5-diene-1-carboxylic acid
4-methylcyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 55299625) has the molecular formula C8H10O2
and a molecular weight of 138.17 g/mol. Its IUPAC name is 4-methylcyclohexa-1,5-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-methylcyclohexa-1,5-diene-1-carboxylic acid |
| PubChem CID | 55299625 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | 4-methylcyclohexa-1,5-diene-1-carboxylic acid |
| SMILES | CC1C=CC(C(=O)O)=CC1 |
| InChI | InChI=1S/C8H10O2/c1-6-2-4-7(5-3-6)8(9)10/h2,4-6H,3H2,1H3,(H,9,10) |
| InChIKey | JZPXKGGGCNDUKX-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-methylcyclohexa-1,5-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylcyclohexa-1,5-diene-1-carboxylic acid?
The IUPAC name of 4-methylcyclohexa-1,5-diene-1-carboxylic acid (CID 55299625) is 4-methylcyclohexa-1,5-diene-1-carboxylic acid.
What is the SMILES notation for 4-methylcyclohexa-1,5-diene-1-carboxylic acid?
The canonical SMILES for 4-methylcyclohexa-1,5-diene-1-carboxylic acid is CC1C=CC(C(=O)O)=CC1.
What is the InChIKey of 4-methylcyclohexa-1,5-diene-1-carboxylic acid?
The InChIKey is JZPXKGGGCNDUKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2/c1-6-2-4-7(5-3-6)8(9)10/h2,4-6H,3H2,1H3,(H,9,10).
What are the key properties of 4-methylcyclohexa-1,5-diene-1-carboxylic acid?
4-methylcyclohexa-1,5-diene-1-carboxylic acid has a molecular weight of 138.17 g/mol, XLogP of 1.59, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylcyclohexa-1,5-diene-1-carboxylic acid is sourced from PubChem (CID 55299625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).