About (3R)-3,4-dimethylpent-4-enoic acid
(3R)-3,4-dimethylpent-4-enoic acid (PubChem CID 55299638) has the molecular formula C7H12O2
and a molecular weight of 128.17 g/mol. Its IUPAC name is (3R)-3,4-dimethylpent-4-enoic acid.
Molecular Properties
| Compound Name | (3R)-3,4-dimethylpent-4-enoic acid |
| PubChem CID | 55299638 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | (3R)-3,4-dimethylpent-4-enoic acid |
| SMILES | C=C(C)[C@H](C)CC(=O)O |
| InChI | InChI=1S/C7H12O2/c1-5(2)6(3)4-7(8)9/h6H,1,4H2,2-3H3,(H,8,9)/t6-/m1/s1 |
| InChIKey | LVPZJCLTIBDEAT-ZCFIWIBFSA-N |
| XLogP | 1.67 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3,4-dimethylpent-4-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3,4-dimethylpent-4-enoic acid?
The IUPAC name of (3R)-3,4-dimethylpent-4-enoic acid (CID 55299638) is (3R)-3,4-dimethylpent-4-enoic acid.
What is the SMILES notation for (3R)-3,4-dimethylpent-4-enoic acid?
The canonical SMILES for (3R)-3,4-dimethylpent-4-enoic acid is C=C(C)[C@H](C)CC(=O)O.
What is the InChIKey of (3R)-3,4-dimethylpent-4-enoic acid?
The InChIKey is LVPZJCLTIBDEAT-ZCFIWIBFSA-N. The full InChI is InChI=1S/C7H12O2/c1-5(2)6(3)4-7(8)9/h6H,1,4H2,2-3H3,(H,8,9)/t6-/m1/s1.
What are the key properties of (3R)-3,4-dimethylpent-4-enoic acid?
(3R)-3,4-dimethylpent-4-enoic acid has a molecular weight of 128.17 g/mol, XLogP of 1.67, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3,4-dimethylpent-4-enoic acid is sourced from PubChem (CID 55299638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).