About 3-methyl-4-propyl-1,2-dihydropyrrol-5-one
3-methyl-4-propyl-1,2-dihydropyrrol-5-one (PubChem CID 55299700) has the molecular formula C8H13NO
and a molecular weight of 139.20 g/mol. Its IUPAC name is 3-methyl-4-propyl-1,2-dihydropyrrol-5-one.
Molecular Properties
| Compound Name | 3-methyl-4-propyl-1,2-dihydropyrrol-5-one |
| PubChem CID | 55299700 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 3-methyl-4-propyl-1,2-dihydropyrrol-5-one |
| SMILES | CCCC1=C(C)CNC1=O |
| InChI | InChI=1S/C8H13NO/c1-3-4-7-6(2)5-9-8(7)10/h3-5H2,1-2H3,(H,9,10) |
| InChIKey | YXUXYVQZWARXQN-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methyl-4-propyl-1,2-dihydropyrrol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4-propyl-1,2-dihydropyrrol-5-one?
The IUPAC name of 3-methyl-4-propyl-1,2-dihydropyrrol-5-one (CID 55299700) is 3-methyl-4-propyl-1,2-dihydropyrrol-5-one.
What is the SMILES notation for 3-methyl-4-propyl-1,2-dihydropyrrol-5-one?
The canonical SMILES for 3-methyl-4-propyl-1,2-dihydropyrrol-5-one is CCCC1=C(C)CNC1=O.
What is the InChIKey of 3-methyl-4-propyl-1,2-dihydropyrrol-5-one?
The InChIKey is YXUXYVQZWARXQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO/c1-3-4-7-6(2)5-9-8(7)10/h3-5H2,1-2H3,(H,9,10).
What are the key properties of 3-methyl-4-propyl-1,2-dihydropyrrol-5-one?
3-methyl-4-propyl-1,2-dihydropyrrol-5-one has a molecular weight of 139.20 g/mol, XLogP of 1.23, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4-propyl-1,2-dihydropyrrol-5-one is sourced from PubChem (CID 55299700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).