About 2-propan-2-yl-2,5-dihydro-1H-imidazole
2-propan-2-yl-2,5-dihydro-1H-imidazole (PubChem CID 55299710) has the molecular formula C6H12N2
and a molecular weight of 112.18 g/mol. Its IUPAC name is 2-propan-2-yl-2,5-dihydro-1H-imidazole.
Molecular Properties
| Compound Name | 2-propan-2-yl-2,5-dihydro-1H-imidazole |
| PubChem CID | 55299710 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | 2-propan-2-yl-2,5-dihydro-1H-imidazole |
| SMILES | CC(C)C1N=CCN1 |
| InChI | InChI=1S/C6H12N2/c1-5(2)6-7-3-4-8-6/h3,5-6,8H,4H2,1-2H3 |
| InChIKey | ILQDWWFUXXPSSG-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-propan-2-yl-2,5-dihydro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yl-2,5-dihydro-1H-imidazole?
The IUPAC name of 2-propan-2-yl-2,5-dihydro-1H-imidazole (CID 55299710) is 2-propan-2-yl-2,5-dihydro-1H-imidazole.
What is the SMILES notation for 2-propan-2-yl-2,5-dihydro-1H-imidazole?
The canonical SMILES for 2-propan-2-yl-2,5-dihydro-1H-imidazole is CC(C)C1N=CCN1.
What is the InChIKey of 2-propan-2-yl-2,5-dihydro-1H-imidazole?
The InChIKey is ILQDWWFUXXPSSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2/c1-5(2)6-7-3-4-8-6/h3,5-6,8H,4H2,1-2H3.
What are the key properties of 2-propan-2-yl-2,5-dihydro-1H-imidazole?
2-propan-2-yl-2,5-dihydro-1H-imidazole has a molecular weight of 112.18 g/mol, XLogP of 0.64, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yl-2,5-dihydro-1H-imidazole is sourced from PubChem (CID 55299710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).