About (4S,5S)-4,5-dimethylimidazolidine
(4S,5S)-4,5-dimethylimidazolidine (PubChem CID 55299832) has the molecular formula C5H12N2
and a molecular weight of 100.17 g/mol. Its IUPAC name is (4S,5S)-4,5-dimethylimidazolidine.
Molecular Properties
| Compound Name | (4S,5S)-4,5-dimethylimidazolidine |
| PubChem CID | 55299832 |
| Molecular Formula | C5H12N2 |
| Molecular Weight | 100.17 g/mol |
| Exact Mass | 100.10 |
| IUPAC Name | (4S,5S)-4,5-dimethylimidazolidine |
| SMILES | C[C@@H]1NCN[C@H]1C |
| InChI | InChI=1S/C5H12N2/c1-4-5(2)7-3-6-4/h4-7H,3H2,1-2H3/t4-,5-/m0/s1 |
| InChIKey | HSYZXEGREXPLBS-WHFBIAKZSA-N |
| XLogP | -0.09 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.17 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S,5S)-4,5-dimethylimidazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,5S)-4,5-dimethylimidazolidine?
The IUPAC name of (4S,5S)-4,5-dimethylimidazolidine (CID 55299832) is (4S,5S)-4,5-dimethylimidazolidine.
What is the SMILES notation for (4S,5S)-4,5-dimethylimidazolidine?
The canonical SMILES for (4S,5S)-4,5-dimethylimidazolidine is C[C@@H]1NCN[C@H]1C.
What is the InChIKey of (4S,5S)-4,5-dimethylimidazolidine?
The InChIKey is HSYZXEGREXPLBS-WHFBIAKZSA-N. The full InChI is InChI=1S/C5H12N2/c1-4-5(2)7-3-6-4/h4-7H,3H2,1-2H3/t4-,5-/m0/s1.
What are the key properties of (4S,5S)-4,5-dimethylimidazolidine?
(4S,5S)-4,5-dimethylimidazolidine has a molecular weight of 100.17 g/mol, XLogP of -0.09, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,5S)-4,5-dimethylimidazolidine is sourced from PubChem (CID 55299832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).