About 2,3,4,6-tetrahydro-1H-purine
2,3,4,6-tetrahydro-1H-purine (PubChem CID 55300020) has the molecular formula C5H8N4
and a molecular weight of 124.15 g/mol. Its IUPAC name is 2,3,4,6-tetrahydro-1H-purine.
Molecular Properties
| Compound Name | 2,3,4,6-tetrahydro-1H-purine |
| PubChem CID | 55300020 |
| Molecular Formula | C5H8N4 |
| Molecular Weight | 124.15 g/mol |
| Exact Mass | 124.07 |
| IUPAC Name | 2,3,4,6-tetrahydro-1H-purine |
| SMILES | C1=NC2NCNCC2=N1 |
| InChI | InChI=1S/C5H8N4/c1-4-5(8-2-6-1)9-3-7-4/h3,5-6,8H,1-2H2 |
| InChIKey | ICVMXSVIRFSZNT-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.15 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3,4,6-tetrahydro-1H-purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4,6-tetrahydro-1H-purine?
The IUPAC name of 2,3,4,6-tetrahydro-1H-purine (CID 55300020) is 2,3,4,6-tetrahydro-1H-purine.
What is the SMILES notation for 2,3,4,6-tetrahydro-1H-purine?
The canonical SMILES for 2,3,4,6-tetrahydro-1H-purine is C1=NC2NCNCC2=N1.
What is the InChIKey of 2,3,4,6-tetrahydro-1H-purine?
The InChIKey is ICVMXSVIRFSZNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N4/c1-4-5(8-2-6-1)9-3-7-4/h3,5-6,8H,1-2H2.
What are the key properties of 2,3,4,6-tetrahydro-1H-purine?
2,3,4,6-tetrahydro-1H-purine has a molecular weight of 124.15 g/mol, XLogP of -1.05, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4,6-tetrahydro-1H-purine is sourced from PubChem (CID 55300020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).