C8H12N2 — CID 55300274
(2S,3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole-2-carbonitrile (PubChem CID 55300274) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is (2S,3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole-2-carbonitrile.
| Compound Name | (2S,3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 55300274 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | (2S,3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole-2-carbonitrile |
| SMILES | N#C[C@@H]1C[C@@H]2CCC[C@H]2N1 |
| InChI | InChI=1S/C8H12N2/c9-5-7-4-6-2-1-3-8(6)10-7/h6-8,10H,1-4H2/t6-,7-,8+/m0/s1 |
| InChIKey | ZYWCCQZJLJTZIP-BIIVOSGPSA-N |
| XLogP | 1.04 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |