C8H11NO — CID 55300299
(3aS,7aS)-2,3,3a,6,7,7a-hexahydroisoindol-1-one (PubChem CID 55300299) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is (3aS,7aS)-2,3,3a,6,7,7a-hexahydroisoindol-1-one.
| Compound Name | (3aS,7aS)-2,3,3a,6,7,7a-hexahydroisoindol-1-one |
|---|---|
| PubChem CID | 55300299 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | (3aS,7aS)-2,3,3a,6,7,7a-hexahydroisoindol-1-one |
| SMILES | O=C1NC[C@H]2C=CCC[C@H]12 |
| InChI | InChI=1S/C8H11NO/c10-8-7-4-2-1-3-6(7)5-9-8/h1,3,6-7H,2,4-5H2,(H,9,10)/t6-,7+/m1/s1 |
| InChIKey | OCMLPHJOJCNQSS-RQJHMYQMSA-N |
| XLogP | 0.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|