trans-(1R,2R)-2-ethenylcyclopropane-1-carboxylic acid

C6H8O2 — CID 55300474

IUPACtrans-(1R,2R)-2-ethenylcyclopropane-1-carboxylic acid
SMILESC=C[C@H]1C[C@H]1C(=O)O
InChIInChI=1S/C6H8O2/c1-2-4-3-5(4)6(7)8/h2,4-5H,1,3H2,(H,7,8)/t4-,5+/m0/s1
InChIKeyRITCJGIGTNSDKO-CRCLSJGQSA-N
MW112.13 g/mol
LogP0.89
Rot. Bonds2

About trans-(1R,2R)-2-ethenylcyclopropane-1-carboxylic acid

trans-(1R,2R)-2-ethenylcyclopropane-1-carboxylic acid (PubChem CID 55300474) has the molecular formula C6H8O2 and a molecular weight of 112.13 g/mol. Its IUPAC name is trans-(1R,2R)-2-ethenylcyclopropane-1-carboxylic acid.

Molecular Properties

Compound Nametrans-(1R,2R)-2-ethenylcyclopropane-1-carboxylic acid
PubChem CID55300474
Molecular FormulaC6H8O2
Molecular Weight112.13 g/mol
Exact Mass112.05
IUPAC Nametrans-(1R,2R)-2-ethenylcyclopropane-1-carboxylic acid
SMILESC=C[C@H]1C[C@H]1C(=O)O
InChIInChI=1S/C6H8O2/c1-2-4-3-5(4)6(7)8/h2,4-5H,1,3H2,(H,7,8)/t4-,5+/m0/s1
InChIKeyRITCJGIGTNSDKO-CRCLSJGQSA-N
XLogP0.89
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms8
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500112.13
LogP ≤ 50.89
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze trans-(1R,2R)-2-ethenylcyclopropane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of trans-(1R,2R)-2-ethenylcyclopropane-1-carboxylic acid?
The IUPAC name of trans-(1R,2R)-2-ethenylcyclopropane-1-carboxylic acid (CID 55300474) is trans-(1R,2R)-2-ethenylcyclopropane-1-carboxylic acid.
What is the SMILES notation for trans-(1R,2R)-2-ethenylcyclopropane-1-carboxylic acid?
The canonical SMILES for trans-(1R,2R)-2-ethenylcyclopropane-1-carboxylic acid is C=C[C@H]1C[C@H]1C(=O)O.
What is the InChIKey of trans-(1R,2R)-2-ethenylcyclopropane-1-carboxylic acid?
The InChIKey is RITCJGIGTNSDKO-CRCLSJGQSA-N. The full InChI is InChI=1S/C6H8O2/c1-2-4-3-5(4)6(7)8/h2,4-5H,1,3H2,(H,7,8)/t4-,5+/m0/s1.
What are the key properties of trans-(1R,2R)-2-ethenylcyclopropane-1-carboxylic acid?
trans-(1R,2R)-2-ethenylcyclopropane-1-carboxylic acid has a molecular weight of 112.13 g/mol, XLogP of 0.89, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-2-ethenylcyclopropane-1-carboxylic acid is sourced from PubChem (CID 55300474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).