5-methyl-1,2-thiazole-3-carboxylic acid

C5H5NO2S — CID 55300483

IUPAC5-methyl-1,2-thiazole-3-carboxylic acid
SMILESCc1cc(C(=O)O)ns1
InChIInChI=1S/C5H5NO2S/c1-3-2-4(5(7)8)6-9-3/h2H,1H3,(H,7,8)
InChIKeyQRHWGPSYZLZEMB-UHFFFAOYSA-N
MW143.17 g/mol
LogP1.15
Rot. Bonds1

About 5-methyl-1,2-thiazole-3-carboxylic acid

5-methyl-1,2-thiazole-3-carboxylic acid (PubChem CID 55300483) has the molecular formula C5H5NO2S and a molecular weight of 143.17 g/mol. Its IUPAC name is 5-methyl-1,2-thiazole-3-carboxylic acid.

Molecular Properties

Compound Name5-methyl-1,2-thiazole-3-carboxylic acid
PubChem CID55300483
Molecular FormulaC5H5NO2S
Molecular Weight143.17 g/mol
Exact Mass143.00
IUPAC Name5-methyl-1,2-thiazole-3-carboxylic acid
SMILESCc1cc(C(=O)O)ns1
InChIInChI=1S/C5H5NO2S/c1-3-2-4(5(7)8)6-9-3/h2H,1H3,(H,7,8)
InChIKeyQRHWGPSYZLZEMB-UHFFFAOYSA-N
XLogP1.15
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500143.17
LogP ≤ 51.15
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5-methyl-1,2-thiazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-methyl-1,2-thiazole-3-carboxylic acid?
The IUPAC name of 5-methyl-1,2-thiazole-3-carboxylic acid (CID 55300483) is 5-methyl-1,2-thiazole-3-carboxylic acid.
What is the SMILES notation for 5-methyl-1,2-thiazole-3-carboxylic acid?
The canonical SMILES for 5-methyl-1,2-thiazole-3-carboxylic acid is Cc1cc(C(=O)O)ns1.
What is the InChIKey of 5-methyl-1,2-thiazole-3-carboxylic acid?
The InChIKey is QRHWGPSYZLZEMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO2S/c1-3-2-4(5(7)8)6-9-3/h2H,1H3,(H,7,8).
What are the key properties of 5-methyl-1,2-thiazole-3-carboxylic acid?
5-methyl-1,2-thiazole-3-carboxylic acid has a molecular weight of 143.17 g/mol, XLogP of 1.15, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1,2-thiazole-3-carboxylic acid is sourced from PubChem (CID 55300483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).