About 1,4-dihydrofuro[2,3-d]pyrimidine
1,4-dihydrofuro[2,3-d]pyrimidine (PubChem CID 55300516) has the molecular formula C6H6N2O
and a molecular weight of 122.13 g/mol. Its IUPAC name is 1,4-dihydrofuro[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 1,4-dihydrofuro[2,3-d]pyrimidine |
| PubChem CID | 55300516 |
| Molecular Formula | C6H6N2O |
| Molecular Weight | 122.13 g/mol |
| Exact Mass | 122.05 |
| IUPAC Name | 1,4-dihydrofuro[2,3-d]pyrimidine |
| SMILES | C1=NCc2ccoc2N1 |
| InChI | InChI=1S/C6H6N2O/c1-2-9-6-5(1)3-7-4-8-6/h1-2,4H,3H2,(H,7,8) |
| InChIKey | IDYOBKFCPNCCOL-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.13 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,4-dihydrofuro[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dihydrofuro[2,3-d]pyrimidine?
The IUPAC name of 1,4-dihydrofuro[2,3-d]pyrimidine (CID 55300516) is 1,4-dihydrofuro[2,3-d]pyrimidine.
What is the SMILES notation for 1,4-dihydrofuro[2,3-d]pyrimidine?
The canonical SMILES for 1,4-dihydrofuro[2,3-d]pyrimidine is C1=NCc2ccoc2N1.
What is the InChIKey of 1,4-dihydrofuro[2,3-d]pyrimidine?
The InChIKey is IDYOBKFCPNCCOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O/c1-2-9-6-5(1)3-7-4-8-6/h1-2,4H,3H2,(H,7,8).
What are the key properties of 1,4-dihydrofuro[2,3-d]pyrimidine?
1,4-dihydrofuro[2,3-d]pyrimidine has a molecular weight of 122.13 g/mol, XLogP of 1.23, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dihydrofuro[2,3-d]pyrimidine is sourced from PubChem (CID 55300516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).