C8H12O2 — CID 55300613
trans-(1S,3R)-3-ethenyl-2,2-dimethylcyclopropane-1-carboxylic acid (PubChem CID 55300613) has the molecular formula C8H12O2 and a molecular weight of 140.18 g/mol. Its IUPAC name is trans-(1S,3R)-3-ethenyl-2,2-dimethylcyclopropane-1-carboxylic acid.
| Compound Name | trans-(1S,3R)-3-ethenyl-2,2-dimethylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 55300613 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | trans-(1S,3R)-3-ethenyl-2,2-dimethylcyclopropane-1-carboxylic acid |
| SMILES | C=C[C@@H]1[C@H](C(=O)O)C1(C)C |
| InChI | InChI=1S/C8H12O2/c1-4-5-6(7(9)10)8(5,2)3/h4-6H,1H2,2-3H3,(H,9,10)/t5-,6-/m1/s1 |
| InChIKey | CAOJXVMGSRHFGB-PHDIDXHHSA-N |
| XLogP | 1.53 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|