About (4R,5S)-5-ethenyl-4-(hydroxymethyl)-1,3-oxazolidin-2-one
(4R,5S)-5-ethenyl-4-(hydroxymethyl)-1,3-oxazolidin-2-one (PubChem CID 55300645) has the molecular formula C6H9NO3
and a molecular weight of 143.14 g/mol. Its IUPAC name is (4R,5S)-5-ethenyl-4-(hydroxymethyl)-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | (4R,5S)-5-ethenyl-4-(hydroxymethyl)-1,3-oxazolidin-2-one |
| PubChem CID | 55300645 |
| Molecular Formula | C6H9NO3 |
| Molecular Weight | 143.14 g/mol |
| Exact Mass | 143.06 |
| IUPAC Name | (4R,5S)-5-ethenyl-4-(hydroxymethyl)-1,3-oxazolidin-2-one |
| SMILES | C=C[C@@H]1OC(=O)N[C@@H]1CO |
| InChI | InChI=1S/C6H9NO3/c1-2-5-4(3-8)7-6(9)10-5/h2,4-5,8H,1,3H2,(H,7,9)/t4-,5+/m1/s1 |
| InChIKey | BQBOIWRWDCJNHC-UHNVWZDZSA-N |
| XLogP | -0.36 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.14 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4R,5S)-5-ethenyl-4-(hydroxymethyl)-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,5S)-5-ethenyl-4-(hydroxymethyl)-1,3-oxazolidin-2-one?
The IUPAC name of (4R,5S)-5-ethenyl-4-(hydroxymethyl)-1,3-oxazolidin-2-one (CID 55300645) is (4R,5S)-5-ethenyl-4-(hydroxymethyl)-1,3-oxazolidin-2-one.
What is the SMILES notation for (4R,5S)-5-ethenyl-4-(hydroxymethyl)-1,3-oxazolidin-2-one?
The canonical SMILES for (4R,5S)-5-ethenyl-4-(hydroxymethyl)-1,3-oxazolidin-2-one is C=C[C@@H]1OC(=O)N[C@@H]1CO.
What is the InChIKey of (4R,5S)-5-ethenyl-4-(hydroxymethyl)-1,3-oxazolidin-2-one?
The InChIKey is BQBOIWRWDCJNHC-UHNVWZDZSA-N. The full InChI is InChI=1S/C6H9NO3/c1-2-5-4(3-8)7-6(9)10-5/h2,4-5,8H,1,3H2,(H,7,9)/t4-,5+/m1/s1.
What are the key properties of (4R,5S)-5-ethenyl-4-(hydroxymethyl)-1,3-oxazolidin-2-one?
(4R,5S)-5-ethenyl-4-(hydroxymethyl)-1,3-oxazolidin-2-one has a molecular weight of 143.14 g/mol, XLogP of -0.36, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,5S)-5-ethenyl-4-(hydroxymethyl)-1,3-oxazolidin-2-one is sourced from PubChem (CID 55300645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).