C5H9NOS — CID 55300849
(4S,5S)-4,5-dimethyl-1,3-oxazolidine-2-thione (PubChem CID 55300849) has the molecular formula C5H9NOS and a molecular weight of 131.20 g/mol. Its IUPAC name is (4S,5S)-4,5-dimethyl-1,3-oxazolidine-2-thione.
| Compound Name | (4S,5S)-4,5-dimethyl-1,3-oxazolidine-2-thione |
|---|---|
| PubChem CID | 55300849 |
| Molecular Formula | C5H9NOS |
| Molecular Weight | 131.20 g/mol |
| Exact Mass | 131.04 |
| IUPAC Name | (4S,5S)-4,5-dimethyl-1,3-oxazolidine-2-thione |
| SMILES | C[C@@H]1NC(=S)O[C@H]1C |
| InChI | InChI=1S/C5H9NOS/c1-3-4(2)7-5(8)6-3/h3-4H,1-2H3,(H,6,8)/t3-,4-/m0/s1 |
| InChIKey | JJKNAKGJWMEEFE-IMJSIDKUSA-N |
| XLogP | 0.67 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.20 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|