About 1,2,3,5,6,7-hexahydropyrrolo[1,2-c]pyrimidine
1,2,3,5,6,7-hexahydropyrrolo[1,2-c]pyrimidine (PubChem CID 55300889) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is 1,2,3,5,6,7-hexahydropyrrolo[1,2-c]pyrimidine.
Analyze 1,2,3,5,6,7-hexahydropyrrolo[1,2-c]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3,5,6,7-hexahydropyrrolo[1,2-c]pyrimidine?
The IUPAC name of 1,2,3,5,6,7-hexahydropyrrolo[1,2-c]pyrimidine (CID 55300889) is 1,2,3,5,6,7-hexahydropyrrolo[1,2-c]pyrimidine.
What is the SMILES notation for 1,2,3,5,6,7-hexahydropyrrolo[1,2-c]pyrimidine?
The canonical SMILES for 1,2,3,5,6,7-hexahydropyrrolo[1,2-c]pyrimidine is C1=C2CCCN2CNC1.
What is the InChIKey of 1,2,3,5,6,7-hexahydropyrrolo[1,2-c]pyrimidine?
The InChIKey is KEMZKHGBXPOIOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2/c1-2-7-3-4-8-6-9(7)5-1/h3,8H,1-2,4-6H2.
What are the key properties of 1,2,3,5,6,7-hexahydropyrrolo[1,2-c]pyrimidine?
1,2,3,5,6,7-hexahydropyrrolo[1,2-c]pyrimidine has a molecular weight of 124.19 g/mol, XLogP of 0.53, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3,5,6,7-hexahydropyrrolo[1,2-c]pyrimidine is sourced from PubChem (CID 55300889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).