About 3-methyl-1H-pyrrole-2,4-dicarbaldehyde
3-methyl-1H-pyrrole-2,4-dicarbaldehyde (PubChem CID 55300981) has the molecular formula C7H7NO2
and a molecular weight of 137.14 g/mol. Its IUPAC name is 3-methyl-1H-pyrrole-2,4-dicarbaldehyde.
Molecular Properties
| Compound Name | 3-methyl-1H-pyrrole-2,4-dicarbaldehyde |
| PubChem CID | 55300981 |
| Molecular Formula | C7H7NO2 |
| Molecular Weight | 137.14 g/mol |
| Exact Mass | 137.05 |
| IUPAC Name | 3-methyl-1H-pyrrole-2,4-dicarbaldehyde |
| SMILES | Cc1c(C=O)c[nH]c1C=O |
| InChI | InChI=1S/C7H7NO2/c1-5-6(3-9)2-8-7(5)4-10/h2-4,8H,1H3 |
| InChIKey | CLYVKDVBFOPSCO-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.14 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-1H-pyrrole-2,4-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1H-pyrrole-2,4-dicarbaldehyde?
The IUPAC name of 3-methyl-1H-pyrrole-2,4-dicarbaldehyde (CID 55300981) is 3-methyl-1H-pyrrole-2,4-dicarbaldehyde.
What is the SMILES notation for 3-methyl-1H-pyrrole-2,4-dicarbaldehyde?
The canonical SMILES for 3-methyl-1H-pyrrole-2,4-dicarbaldehyde is Cc1c(C=O)c[nH]c1C=O.
What is the InChIKey of 3-methyl-1H-pyrrole-2,4-dicarbaldehyde?
The InChIKey is CLYVKDVBFOPSCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2/c1-5-6(3-9)2-8-7(5)4-10/h2-4,8H,1H3.
What are the key properties of 3-methyl-1H-pyrrole-2,4-dicarbaldehyde?
3-methyl-1H-pyrrole-2,4-dicarbaldehyde has a molecular weight of 137.14 g/mol, XLogP of 0.95, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1H-pyrrole-2,4-dicarbaldehyde is sourced from PubChem (CID 55300981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).