(2S)-2,5-dimethylcyclopentane-1-carboxylic acid

C8H14O2 — CID 55301029

IUPAC(2S)-2,5-dimethylcyclopentane-1-carboxylic acid
SMILESCC1CC[C@H](C)C1C(=O)O
InChIInChI=1S/C8H14O2/c1-5-3-4-6(2)7(5)8(9)10/h5-7H,3-4H2,1-2H3,(H,9,10)/t5-,6?,7?/m0/s1
InChIKeyALAHNIFCYINFGN-VTSJMVTISA-N
MW142.20 g/mol
LogP1.75
Rot. Bonds1

About (2S)-2,5-dimethylcyclopentane-1-carboxylic acid

(2S)-2,5-dimethylcyclopentane-1-carboxylic acid (PubChem CID 55301029) has the molecular formula C8H14O2 and a molecular weight of 142.20 g/mol. Its IUPAC name is (2S)-2,5-dimethylcyclopentane-1-carboxylic acid.

Molecular Properties

Compound Name(2S)-2,5-dimethylcyclopentane-1-carboxylic acid
PubChem CID55301029
Molecular FormulaC8H14O2
Molecular Weight142.20 g/mol
Exact Mass142.10
IUPAC Name(2S)-2,5-dimethylcyclopentane-1-carboxylic acid
SMILESCC1CC[C@H](C)C1C(=O)O
InChIInChI=1S/C8H14O2/c1-5-3-4-6(2)7(5)8(9)10/h5-7H,3-4H2,1-2H3,(H,9,10)/t5-,6?,7?/m0/s1
InChIKeyALAHNIFCYINFGN-VTSJMVTISA-N
XLogP1.75
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500142.20
LogP ≤ 51.75
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze (2S)-2,5-dimethylcyclopentane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2,5-dimethylcyclopentane-1-carboxylic acid?
The IUPAC name of (2S)-2,5-dimethylcyclopentane-1-carboxylic acid (CID 55301029) is (2S)-2,5-dimethylcyclopentane-1-carboxylic acid.
What is the SMILES notation for (2S)-2,5-dimethylcyclopentane-1-carboxylic acid?
The canonical SMILES for (2S)-2,5-dimethylcyclopentane-1-carboxylic acid is CC1CC[C@H](C)C1C(=O)O.
What is the InChIKey of (2S)-2,5-dimethylcyclopentane-1-carboxylic acid?
The InChIKey is ALAHNIFCYINFGN-VTSJMVTISA-N. The full InChI is InChI=1S/C8H14O2/c1-5-3-4-6(2)7(5)8(9)10/h5-7H,3-4H2,1-2H3,(H,9,10)/t5-,6?,7?/m0/s1.
What are the key properties of (2S)-2,5-dimethylcyclopentane-1-carboxylic acid?
(2S)-2,5-dimethylcyclopentane-1-carboxylic acid has a molecular weight of 142.20 g/mol, XLogP of 1.75, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,5-dimethylcyclopentane-1-carboxylic acid is sourced from PubChem (CID 55301029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).