C7H15N3 — CID 55301542
(2R,4S)-2,4,6,6-tetramethyl-1,3,5-triazabicyclo[3.1.0]hexane (PubChem CID 55301542) has the molecular formula C7H15N3 and a molecular weight of 141.22 g/mol. Its IUPAC name is (2R,4S)-2,4,6,6-tetramethyl-1,3,5-triazabicyclo[3.1.0]hexane.
| Compound Name | (2R,4S)-2,4,6,6-tetramethyl-1,3,5-triazabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 55301542 |
| Molecular Formula | C7H15N3 |
| Molecular Weight | 141.22 g/mol |
| Exact Mass | 141.13 |
| IUPAC Name | (2R,4S)-2,4,6,6-tetramethyl-1,3,5-triazabicyclo[3.1.0]hexane |
| SMILES | C[C@@H]1N[C@H](C)N2N1C2(C)C |
| InChI | InChI=1S/C7H15N3/c1-5-8-6(2)10-7(3,4)9(5)10/h5-6,8H,1-4H3/t5-,6+,9?,10? |
| InChIKey | QQXCNZWUCAKXRG-XQWDCPGCSA-N |
| XLogP | 0.55 |
| TPSA | 18.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.22 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|