About 4,5-dichloropent-1-yne
4,5-dichloropent-1-yne (PubChem CID 55301698) has the molecular formula C5H6Cl2
and a molecular weight of 137.01 g/mol. Its IUPAC name is 4,5-dichloropent-1-yne.
Molecular Properties
| Compound Name | 4,5-dichloropent-1-yne |
| PubChem CID | 55301698 |
| Molecular Formula | C5H6Cl2 |
| Molecular Weight | 137.01 g/mol |
| Exact Mass | 135.98 |
| IUPAC Name | 4,5-dichloropent-1-yne |
| SMILES | C#CCC(Cl)CCl |
| InChI | InChI=1S/C5H6Cl2/c1-2-3-5(7)4-6/h1,5H,3-4H2 |
| InChIKey | OFRQEMOGWMYRMR-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.01 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dichloropent-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dichloropent-1-yne?
The IUPAC name of 4,5-dichloropent-1-yne (CID 55301698) is 4,5-dichloropent-1-yne.
What is the SMILES notation for 4,5-dichloropent-1-yne?
The canonical SMILES for 4,5-dichloropent-1-yne is C#CCC(Cl)CCl.
What is the InChIKey of 4,5-dichloropent-1-yne?
The InChIKey is OFRQEMOGWMYRMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6Cl2/c1-2-3-5(7)4-6/h1,5H,3-4H2.
What are the key properties of 4,5-dichloropent-1-yne?
4,5-dichloropent-1-yne has a molecular weight of 137.01 g/mol, XLogP of 1.86, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dichloropent-1-yne is sourced from PubChem (CID 55301698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).