About 6-chloro-2-methylhexa-1,3,4-triene
6-chloro-2-methylhexa-1,3,4-triene (PubChem CID 55301873) has the molecular formula C7H9Cl
and a molecular weight of 128.60 g/mol. Its IUPAC name is 6-chloro-2-methylhexa-1,3,4-triene.
Molecular Properties
| Compound Name | 6-chloro-2-methylhexa-1,3,4-triene |
| PubChem CID | 55301873 |
| Molecular Formula | C7H9Cl |
| Molecular Weight | 128.60 g/mol |
| Exact Mass | 128.04 |
| IUPAC Name | 6-chloro-2-methylhexa-1,3,4-triene |
| SMILES | C=C(C)C=C=CCCl |
| InChI | InChI=1S/C7H9Cl/c1-7(2)5-3-4-6-8/h4-5H,1,6H2,2H3 |
| InChIKey | FEBAQTZMMMXQHG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.60 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-2-methylhexa-1,3,4-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-methylhexa-1,3,4-triene?
The IUPAC name of 6-chloro-2-methylhexa-1,3,4-triene (CID 55301873) is 6-chloro-2-methylhexa-1,3,4-triene.
What is the SMILES notation for 6-chloro-2-methylhexa-1,3,4-triene?
The canonical SMILES for 6-chloro-2-methylhexa-1,3,4-triene is C=C(C)C=C=CCCl.
What is the InChIKey of 6-chloro-2-methylhexa-1,3,4-triene?
The InChIKey is FEBAQTZMMMXQHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9Cl/c1-7(2)5-3-4-6-8/h4-5H,1,6H2,2H3.
What are the key properties of 6-chloro-2-methylhexa-1,3,4-triene?
6-chloro-2-methylhexa-1,3,4-triene has a molecular weight of 128.60 g/mol, XLogP of 2.51, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-methylhexa-1,3,4-triene is sourced from PubChem (CID 55301873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).