2,5-dihydrofuran-3-carboxylic acid

C5H6O3 — CID 55302555

IUPAC2,5-dihydrofuran-3-carboxylic acid
SMILESO=C(O)C1=CCOC1
InChIInChI=1S/C5H6O3/c6-5(7)4-1-2-8-3-4/h1H,2-3H2,(H,6,7)
InChIKeyVGPHHRYBFDWNMV-UHFFFAOYSA-N
MW114.10 g/mol
LogP0.03
Rot. Bonds1

About 2,5-dihydrofuran-3-carboxylic acid

2,5-dihydrofuran-3-carboxylic acid (PubChem CID 55302555) has the molecular formula C5H6O3 and a molecular weight of 114.10 g/mol. Its IUPAC name is 2,5-dihydrofuran-3-carboxylic acid.

Molecular Properties

Compound Name2,5-dihydrofuran-3-carboxylic acid
PubChem CID55302555
Molecular FormulaC5H6O3
Molecular Weight114.10 g/mol
Exact Mass114.03
IUPAC Name2,5-dihydrofuran-3-carboxylic acid
SMILESO=C(O)C1=CCOC1
InChIInChI=1S/C5H6O3/c6-5(7)4-1-2-8-3-4/h1H,2-3H2,(H,6,7)
InChIKeyVGPHHRYBFDWNMV-UHFFFAOYSA-N
XLogP0.03
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500114.10
LogP ≤ 50.03
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2,5-dihydrofuran-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,5-dihydrofuran-3-carboxylic acid?
The IUPAC name of 2,5-dihydrofuran-3-carboxylic acid (CID 55302555) is 2,5-dihydrofuran-3-carboxylic acid.
What is the SMILES notation for 2,5-dihydrofuran-3-carboxylic acid?
The canonical SMILES for 2,5-dihydrofuran-3-carboxylic acid is O=C(O)C1=CCOC1.
What is the InChIKey of 2,5-dihydrofuran-3-carboxylic acid?
The InChIKey is VGPHHRYBFDWNMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O3/c6-5(7)4-1-2-8-3-4/h1H,2-3H2,(H,6,7).
What are the key properties of 2,5-dihydrofuran-3-carboxylic acid?
2,5-dihydrofuran-3-carboxylic acid has a molecular weight of 114.10 g/mol, XLogP of 0.03, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dihydrofuran-3-carboxylic acid is sourced from PubChem (CID 55302555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).