C8H11NO — CID 55303231
(1S,3S,6S,8S)-2-oxa-7-azatricyclo[4.4.0.03,8]dec-4-ene (PubChem CID 55303231) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is (1S,3S,6S,8S)-2-oxa-7-azatricyclo[4.4.0.03,8]dec-4-ene.
| Compound Name | (1S,3S,6S,8S)-2-oxa-7-azatricyclo[4.4.0.03,8]dec-4-ene |
|---|---|
| PubChem CID | 55303231 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | (1S,3S,6S,8S)-2-oxa-7-azatricyclo[4.4.0.03,8]dec-4-ene |
| SMILES | C1=C[C@@H]2O[C@H]3CC[C@@H]2N[C@@H]13 |
| InChI | InChI=1S/C8H11NO/c1-3-7-6-2-4-8(10-7)5(1)9-6/h1,3,5-9H,2,4H2/t5-,6-,7-,8-/m0/s1 |
| InChIKey | JXMRSQXFTQCRBJ-XAMCCFCMSA-N |
| XLogP | 0.44 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|