About 4,5-dimethyl-2,5-dihydrofuran-2-carboxylic acid
4,5-dimethyl-2,5-dihydrofuran-2-carboxylic acid (PubChem CID 55303275) has the molecular formula C7H10O3
and a molecular weight of 142.15 g/mol. Its IUPAC name is 4,5-dimethyl-2,5-dihydrofuran-2-carboxylic acid.
Molecular Properties
| Compound Name | 4,5-dimethyl-2,5-dihydrofuran-2-carboxylic acid |
| PubChem CID | 55303275 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | 4,5-dimethyl-2,5-dihydrofuran-2-carboxylic acid |
| SMILES | CC1=CC(C(=O)O)OC1C |
| InChI | InChI=1S/C7H10O3/c1-4-3-6(7(8)9)10-5(4)2/h3,5-6H,1-2H3,(H,8,9) |
| InChIKey | TZWLGOLVBKSRFO-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dimethyl-2,5-dihydrofuran-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-2,5-dihydrofuran-2-carboxylic acid?
The IUPAC name of 4,5-dimethyl-2,5-dihydrofuran-2-carboxylic acid (CID 55303275) is 4,5-dimethyl-2,5-dihydrofuran-2-carboxylic acid.
What is the SMILES notation for 4,5-dimethyl-2,5-dihydrofuran-2-carboxylic acid?
The canonical SMILES for 4,5-dimethyl-2,5-dihydrofuran-2-carboxylic acid is CC1=CC(C(=O)O)OC1C.
What is the InChIKey of 4,5-dimethyl-2,5-dihydrofuran-2-carboxylic acid?
The InChIKey is TZWLGOLVBKSRFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3/c1-4-3-6(7(8)9)10-5(4)2/h3,5-6H,1-2H3,(H,8,9).
What are the key properties of 4,5-dimethyl-2,5-dihydrofuran-2-carboxylic acid?
4,5-dimethyl-2,5-dihydrofuran-2-carboxylic acid has a molecular weight of 142.15 g/mol, XLogP of 0.80, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-2,5-dihydrofuran-2-carboxylic acid is sourced from PubChem (CID 55303275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).