About (2Z,4E)-1,3-dichlorohexa-2,4-diene
(2Z,4E)-1,3-dichlorohexa-2,4-diene (PubChem CID 55303313) has the molecular formula C6H8Cl2
and a molecular weight of 151.04 g/mol. Its IUPAC name is (2Z,4E)-1,3-dichlorohexa-2,4-diene.
Molecular Properties
| Compound Name | (2Z,4E)-1,3-dichlorohexa-2,4-diene |
| PubChem CID | 55303313 |
| Molecular Formula | C6H8Cl2 |
| Molecular Weight | 151.04 g/mol |
| Exact Mass | 150.00 |
| IUPAC Name | (2Z,4E)-1,3-dichlorohexa-2,4-diene |
| SMILES | C/C=C/C(Cl)=C/CCl |
| InChI | InChI=1S/C6H8Cl2/c1-2-3-6(8)4-5-7/h2-4H,5H2,1H3/b3-2+,6-4- |
| InChIKey | DMEVFJCBFZQTSD-ZPYFUIHZSA-N |
| XLogP | 2.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.04 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4E)-1,3-dichlorohexa-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4E)-1,3-dichlorohexa-2,4-diene?
The IUPAC name of (2Z,4E)-1,3-dichlorohexa-2,4-diene (CID 55303313) is (2Z,4E)-1,3-dichlorohexa-2,4-diene.
What is the SMILES notation for (2Z,4E)-1,3-dichlorohexa-2,4-diene?
The canonical SMILES for (2Z,4E)-1,3-dichlorohexa-2,4-diene is C/C=C/C(Cl)=C/CCl.
What is the InChIKey of (2Z,4E)-1,3-dichlorohexa-2,4-diene?
The InChIKey is DMEVFJCBFZQTSD-ZPYFUIHZSA-N. The full InChI is InChI=1S/C6H8Cl2/c1-2-3-6(8)4-5-7/h2-4H,5H2,1H3/b3-2+,6-4-.
What are the key properties of (2Z,4E)-1,3-dichlorohexa-2,4-diene?
(2Z,4E)-1,3-dichlorohexa-2,4-diene has a molecular weight of 151.04 g/mol, XLogP of 2.92, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4E)-1,3-dichlorohexa-2,4-diene is sourced from PubChem (CID 55303313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).