About (E)-2,5-dihydroxypent-3-enoic acid
(E)-2,5-dihydroxypent-3-enoic acid (PubChem CID 55303478) has the molecular formula C5H8O4
and a molecular weight of 132.11 g/mol. Its IUPAC name is (E)-2,5-dihydroxypent-3-enoic acid.
Molecular Properties
| Compound Name | (E)-2,5-dihydroxypent-3-enoic acid |
| PubChem CID | 55303478 |
| Molecular Formula | C5H8O4 |
| Molecular Weight | 132.11 g/mol |
| Exact Mass | 132.04 |
| IUPAC Name | (E)-2,5-dihydroxypent-3-enoic acid |
| SMILES | O=C(O)C(O)/C=C/CO |
| InChI | InChI=1S/C5H8O4/c6-3-1-2-4(7)5(8)9/h1-2,4,6-7H,3H2,(H,8,9)/b2-1+ |
| InChIKey | GJPSTUKDZFMWBP-OWOJBTEDSA-N |
| XLogP | -1.02 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.11 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-2,5-dihydroxypent-3-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2,5-dihydroxypent-3-enoic acid?
The IUPAC name of (E)-2,5-dihydroxypent-3-enoic acid (CID 55303478) is (E)-2,5-dihydroxypent-3-enoic acid.
What is the SMILES notation for (E)-2,5-dihydroxypent-3-enoic acid?
The canonical SMILES for (E)-2,5-dihydroxypent-3-enoic acid is O=C(O)C(O)/C=C/CO.
What is the InChIKey of (E)-2,5-dihydroxypent-3-enoic acid?
The InChIKey is GJPSTUKDZFMWBP-OWOJBTEDSA-N. The full InChI is InChI=1S/C5H8O4/c6-3-1-2-4(7)5(8)9/h1-2,4,6-7H,3H2,(H,8,9)/b2-1+.
What are the key properties of (E)-2,5-dihydroxypent-3-enoic acid?
(E)-2,5-dihydroxypent-3-enoic acid has a molecular weight of 132.11 g/mol, XLogP of -1.02, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,5-dihydroxypent-3-enoic acid is sourced from PubChem (CID 55303478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).