C21H25N3O6S — CID 55305619
[2-oxo-2-(4-sulfamoylanilino)ethyl] 3-methyl-2-[(4-methylbenzoyl)amino]butanoate (PubChem CID 55305619) has the molecular formula C21H25N3O6S and a molecular weight of 447.51 g/mol. Its IUPAC name is [2-oxo-2-(4-sulfamoylanilino)ethyl] 3-methyl-2-[(4-methylbenzoyl)amino]butanoate.
| Compound Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 3-methyl-2-[(4-methylbenzoyl)amino]butanoate |
|---|---|
| PubChem CID | 55305619 |
| Molecular Formula | C21H25N3O6S |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 3-methyl-2-[(4-methylbenzoyl)amino]butanoate |
| SMILES | Cc1ccc(C(=O)NC(C(=O)OCC(=O)Nc2ccc(S(N)(=O)=O)cc2)C(C)C)cc1 |
| InChI | InChI=1S/C21H25N3O6S/c1-13(2)19(24-20(26)15-6-4-14(3)5-7-15)21(27)30-12-18(25)23-16-8-10-17(11-9-16)31(22,28)29/h4-11,13,19H,12H2,1-3H3,(H,23,25)(H,24,26)(H2,22,28,29) |
| InChIKey | DZMLIBPASUQQDT-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 144.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |