C11H28O3Si3 — CID 553067
1,2-bis(trimethylsilyloxy)ethenoxy-trimethylsilane (PubChem CID 553067) has the molecular formula C11H28O3Si3 and a molecular weight of 292.60 g/mol. Its IUPAC name is 1,2-bis(trimethylsilyloxy)ethenoxy-trimethylsilane.
| Compound Name | 1,2-bis(trimethylsilyloxy)ethenoxy-trimethylsilane |
|---|---|
| PubChem CID | 553067 |
| Molecular Formula | C11H28O3Si3 |
| Molecular Weight | 292.60 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 1,2-bis(trimethylsilyloxy)ethenoxy-trimethylsilane |
| SMILES | C[Si](C)(C)OC=C(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C11H28O3Si3/c1-15(2,3)12-10-11(13-16(4,5)6)14-17(7,8)9/h10H,1-9H3 |
| InChIKey | FCZGHPGTZRTDNN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.60 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|