C24H26N4O8 — CID 55307956
N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 55307956) has the molecular formula C24H26N4O8 and a molecular weight of 498.49 g/mol. Its IUPAC name is N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 55307956 |
| Molecular Formula | C24H26N4O8 |
| Molecular Weight | 498.49 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)CN1C(=O)c2cccc([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C24H26N4O8/c1-3-35-19-13-18(26-8-10-34-11-9-26)20(36-4-2)12-16(19)25-21(29)14-27-23(30)15-6-5-7-17(28(32)33)22(15)24(27)31/h5-7,12-13H,3-4,8-11,14H2,1-2H3,(H,25,29) |
| InChIKey | RGWLKIOSMMOYOR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 140.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.49 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|