C17H15BrO5 — CID 55308187
4-O-[2-(4-bromophenoxy)ethyl] 1-O-methyl benzene-1,4-dicarboxylate (PubChem CID 55308187) has the molecular formula C17H15BrO5 and a molecular weight of 379.21 g/mol. Its IUPAC name is 4-O-[2-(4-bromophenoxy)ethyl] 1-O-methyl benzene-1,4-dicarboxylate.
| Compound Name | 4-O-[2-(4-bromophenoxy)ethyl] 1-O-methyl benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 55308187 |
| Molecular Formula | C17H15BrO5 |
| Molecular Weight | 379.21 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | 4-O-[2-(4-bromophenoxy)ethyl] 1-O-methyl benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OCCOc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C17H15BrO5/c1-21-16(19)12-2-4-13(5-3-12)17(20)23-11-10-22-15-8-6-14(18)7-9-15/h2-9H,10-11H2,1H3 |
| InChIKey | UMOOUYQNDKCTPG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.21 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|