trimethylsilyl 2,3-dimethyl-4-trimethylsilyloxybutanoate

C12H28O3Si2 — CID 553085

IUPACtrimethylsilyl 2,3-dimethyl-4-trimethylsilyloxybutanoate
SMILESCC(CO[Si](C)(C)C)C(C)C(=O)O[Si](C)(C)C
InChIInChI=1S/C12H28O3Si2/c1-10(9-14-16(3,4)5)11(2)12(13)15-17(6,7)8/h10-11H,9H2,1-8H3
InChIKeyCJRGUJJNWPYFGG-UHFFFAOYSA-N
MW276.52 g/mol
LogP3.49
Rot. Bonds6

About trimethylsilyl 2,3-dimethyl-4-trimethylsilyloxybutanoate

trimethylsilyl 2,3-dimethyl-4-trimethylsilyloxybutanoate (PubChem CID 553085) has the molecular formula C12H28O3Si2 and a molecular weight of 276.52 g/mol. Its IUPAC name is trimethylsilyl 2,3-dimethyl-4-trimethylsilyloxybutanoate.

Molecular Properties

Compound Nametrimethylsilyl 2,3-dimethyl-4-trimethylsilyloxybutanoate
PubChem CID553085
Molecular FormulaC12H28O3Si2
Molecular Weight276.52 g/mol
Exact Mass276.16
IUPAC Nametrimethylsilyl 2,3-dimethyl-4-trimethylsilyloxybutanoate
SMILESCC(CO[Si](C)(C)C)C(C)C(=O)O[Si](C)(C)C
InChIInChI=1S/C12H28O3Si2/c1-10(9-14-16(3,4)5)11(2)12(13)15-17(6,7)8/h10-11H,9H2,1-8H3
InChIKeyCJRGUJJNWPYFGG-UHFFFAOYSA-N
XLogP3.49
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.52
LogP ≤ 53.49
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze trimethylsilyl 2,3-dimethyl-4-trimethylsilyloxybutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of trimethylsilyl 2,3-dimethyl-4-trimethylsilyloxybutanoate?
The IUPAC name of trimethylsilyl 2,3-dimethyl-4-trimethylsilyloxybutanoate (CID 553085) is trimethylsilyl 2,3-dimethyl-4-trimethylsilyloxybutanoate.
What is the SMILES notation for trimethylsilyl 2,3-dimethyl-4-trimethylsilyloxybutanoate?
The canonical SMILES for trimethylsilyl 2,3-dimethyl-4-trimethylsilyloxybutanoate is CC(CO[Si](C)(C)C)C(C)C(=O)O[Si](C)(C)C.
What is the InChIKey of trimethylsilyl 2,3-dimethyl-4-trimethylsilyloxybutanoate?
The InChIKey is CJRGUJJNWPYFGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H28O3Si2/c1-10(9-14-16(3,4)5)11(2)12(13)15-17(6,7)8/h10-11H,9H2,1-8H3.
What are the key properties of trimethylsilyl 2,3-dimethyl-4-trimethylsilyloxybutanoate?
trimethylsilyl 2,3-dimethyl-4-trimethylsilyloxybutanoate has a molecular weight of 276.52 g/mol, XLogP of 3.49, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trimethylsilyl 2,3-dimethyl-4-trimethylsilyloxybutanoate is sourced from PubChem (CID 553085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).