C14H13NO4 — CID 55310658
2-oxopropyl 5-methyl-2-phenyl-1,3-oxazole-4-carboxylate (PubChem CID 55310658) has the molecular formula C14H13NO4 and a molecular weight of 259.26 g/mol. Its IUPAC name is 2-oxopropyl 5-methyl-2-phenyl-1,3-oxazole-4-carboxylate.
| Compound Name | 2-oxopropyl 5-methyl-2-phenyl-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 55310658 |
| Molecular Formula | C14H13NO4 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 2-oxopropyl 5-methyl-2-phenyl-1,3-oxazole-4-carboxylate |
| SMILES | CC(=O)COC(=O)c1nc(-c2ccccc2)oc1C |
| InChI | InChI=1S/C14H13NO4/c1-9(16)8-18-14(17)12-10(2)19-13(15-12)11-6-4-3-5-7-11/h3-7H,8H2,1-2H3 |
| InChIKey | WQKKIPUUNDUOCW-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |