C18H15ClF3NO5S — CID 55312051
[1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] 4-chloro-3-methylsulfonylbenzoate (PubChem CID 55312051) has the molecular formula C18H15ClF3NO5S and a molecular weight of 449.83 g/mol. Its IUPAC name is [1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] 4-chloro-3-methylsulfonylbenzoate.
| Compound Name | [1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] 4-chloro-3-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 55312051 |
| Molecular Formula | C18H15ClF3NO5S |
| Molecular Weight | 449.83 g/mol |
| Exact Mass | 449.03 |
| IUPAC Name | [1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] 4-chloro-3-methylsulfonylbenzoate |
| SMILES | CC(OC(=O)c1ccc(Cl)c(S(C)(=O)=O)c1)C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H15ClF3NO5S/c1-10(16(24)23-13-6-4-12(5-7-13)18(20,21)22)28-17(25)11-3-8-14(19)15(9-11)29(2,26)27/h3-10H,1-2H3,(H,23,24) |
| InChIKey | DVFIQZKOXXNLQT-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.83 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |