About [1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] 2-[3-(trifluoromethyl)pyrazol-1-yl]acetate
[1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] 2-[3-(trifluoromethyl)pyrazol-1-yl]acetate (PubChem CID 55312452) has the molecular formula C18H19F3N2O3
and a molecular weight of 368.36 g/mol. Its IUPAC name is [1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] 2-[3-(trifluoromethyl)pyrazol-1-yl]acetate.
Molecular Properties
| Compound Name | [1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] 2-[3-(trifluoromethyl)pyrazol-1-yl]acetate |
| PubChem CID | 55312452 |
| Molecular Formula | C18H19F3N2O3 |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | [1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] 2-[3-(trifluoromethyl)pyrazol-1-yl]acetate |
| SMILES | Cc1cc(C)c(C(=O)C(C)OC(=O)Cn2ccc(C(F)(F)F)n2)cc1C |
| InChI | InChI=1S/C18H19F3N2O3/c1-10-7-12(3)14(8-11(10)2)17(25)13(4)26-16(24)9-23-6-5-15(22-23)18(19,20)21/h5-8,13H,9H2,1-4H3 |
| InChIKey | CNJRYSXBJIOSNA-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] 2-[3-(trifluoromethyl)pyrazol-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] 2-[3-(trifluoromethyl)pyrazol-1-yl]acetate?
The IUPAC name of [1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] 2-[3-(trifluoromethyl)pyrazol-1-yl]acetate (CID 55312452) is [1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] 2-[3-(trifluoromethyl)pyrazol-1-yl]acetate.
What is the SMILES notation for [1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] 2-[3-(trifluoromethyl)pyrazol-1-yl]acetate?
The canonical SMILES for [1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] 2-[3-(trifluoromethyl)pyrazol-1-yl]acetate is Cc1cc(C)c(C(=O)C(C)OC(=O)Cn2ccc(C(F)(F)F)n2)cc1C.
What is the InChIKey of [1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] 2-[3-(trifluoromethyl)pyrazol-1-yl]acetate?
The InChIKey is CNJRYSXBJIOSNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19F3N2O3/c1-10-7-12(3)14(8-11(10)2)17(25)13(4)26-16(24)9-23-6-5-15(22-23)18(19,20)21/h5-8,13H,9H2,1-4H3.
What are the key properties of [1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] 2-[3-(trifluoromethyl)pyrazol-1-yl]acetate?
[1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] 2-[3-(trifluoromethyl)pyrazol-1-yl]acetate has a molecular weight of 368.36 g/mol, XLogP of 3.64, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] 2-[3-(trifluoromethyl)pyrazol-1-yl]acetate is sourced from PubChem (CID 55312452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).