C18H23NO6S — CID 55313477
[2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 4-formylbenzoate (PubChem CID 55313477) has the molecular formula C18H23NO6S and a molecular weight of 381.45 g/mol. Its IUPAC name is [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 4-formylbenzoate.
| Compound Name | [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 4-formylbenzoate |
|---|---|
| PubChem CID | 55313477 |
| Molecular Formula | C18H23NO6S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 4-formylbenzoate |
| SMILES | CC(C)CN(C(=O)COC(=O)c1ccc(C=O)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H23NO6S/c1-13(2)9-19(16-7-8-26(23,24)12-16)17(21)11-25-18(22)15-5-3-14(10-20)4-6-15/h3-6,10,13,16H,7-9,11-12H2,1-2H3 |
| InChIKey | JEEDNMJIWOEYSA-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|