C33H83O11PSi8 — CID 553144
2,3-bis(trimethylsilyloxy)propyl [2,3,4,5,6-pentakis(trimethylsilyloxy)cyclohexyl] trimethylsilyl phosphate (PubChem CID 553144) has the molecular formula C33H83O11PSi8 and a molecular weight of 911.68 g/mol. Its IUPAC name is 2,3-bis(trimethylsilyloxy)propyl [2,3,4,5,6-pentakis(trimethylsilyloxy)cyclohexyl] trimethylsilyl phosphate.
| Compound Name | 2,3-bis(trimethylsilyloxy)propyl [2,3,4,5,6-pentakis(trimethylsilyloxy)cyclohexyl] trimethylsilyl phosphate |
|---|---|
| PubChem CID | 553144 |
| Molecular Formula | C33H83O11PSi8 |
| Molecular Weight | 911.68 g/mol |
| Exact Mass | 910.38 |
| IUPAC Name | 2,3-bis(trimethylsilyloxy)propyl [2,3,4,5,6-pentakis(trimethylsilyloxy)cyclohexyl] trimethylsilyl phosphate |
| SMILES | C[Si](C)(C)OCC(COP(=O)(OC1C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C33H83O11PSi8/c1-46(2,3)36-26-27(38-47(4,5)6)25-35-45(34,44-53(22,23)24)37-28-29(39-48(7,8)9)31(41-50(13,14)15)33(43-52(19,20)21)32(42-51(16,17)18)30(28)40-49(10,11)12/h27-33H,25-26H2,1-24H3 |
| InChIKey | KZAXRCMKPPMDAR-UHFFFAOYSA-N |
| XLogP | 10.53 |
| TPSA | 109.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 911.68 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|