C20H60O12Si11 — CID 553150
bis[[(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)oxy-dimethylsilyl]oxy]-dimethylsilane (PubChem CID 553150) has the molecular formula C20H60O12Si11 and a molecular weight of 801.63 g/mol. Its IUPAC name is bis[[(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)oxy-dimethylsilyl]oxy]-dimethylsilane.
| Compound Name | bis[[(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)oxy-dimethylsilyl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 553150 |
| Molecular Formula | C20H60O12Si11 |
| Molecular Weight | 801.63 g/mol |
| Exact Mass | 800.15 |
| IUPAC Name | bis[[(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)oxy-dimethylsilyl]oxy]-dimethylsilane |
| SMILES | C[Si]1(C)O[Si](C)(C)O[Si](C)(O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si]2(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O2)O[Si](C)(C)O1 |
| InChI | InChI=1S/C20H60O12Si11/c1-33(2)21-36(7,8)27-42(19,28-37(9,10)22-33)31-40(15,16)25-35(5,6)26-41(17,18)32-43(20)29-38(11,12)23-34(3,4)24-39(13,14)30-43/h1-20H3 |
| InChIKey | HGZOGGFRBKKHOR-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 110.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.63 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|