C21H31NO5 — CID 55316250
[1-(2-ethylpiperidin-1-yl)-1-oxopropan-2-yl] 3,4-diethoxybenzoate (PubChem CID 55316250) has the molecular formula C21H31NO5 and a molecular weight of 377.48 g/mol. Its IUPAC name is [1-(2-ethylpiperidin-1-yl)-1-oxopropan-2-yl] 3,4-diethoxybenzoate.
| Compound Name | [1-(2-ethylpiperidin-1-yl)-1-oxopropan-2-yl] 3,4-diethoxybenzoate |
|---|---|
| PubChem CID | 55316250 |
| Molecular Formula | C21H31NO5 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | [1-(2-ethylpiperidin-1-yl)-1-oxopropan-2-yl] 3,4-diethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)OC(C)C(=O)N2CCCCC2CC)cc1OCC |
| InChI | InChI=1S/C21H31NO5/c1-5-17-10-8-9-13-22(17)20(23)15(4)27-21(24)16-11-12-18(25-6-2)19(14-16)26-7-3/h11-12,14-15,17H,5-10,13H2,1-4H3 |
| InChIKey | REUNNEWPVYQBEQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |