About trimethyl(7-trimethylsilylhepta-1,6-diynyl)silane
trimethyl(7-trimethylsilylhepta-1,6-diynyl)silane (PubChem CID 553168) has the molecular formula C13H24Si2
and a molecular weight of 236.51 g/mol. Its IUPAC name is trimethyl(7-trimethylsilylhepta-1,6-diynyl)silane.
Molecular Properties
| Compound Name | trimethyl(7-trimethylsilylhepta-1,6-diynyl)silane |
| PubChem CID | 553168 |
| Molecular Formula | C13H24Si2 |
| Molecular Weight | 236.51 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | trimethyl(7-trimethylsilylhepta-1,6-diynyl)silane |
| SMILES | C[Si](C)(C)C#CCCCC#C[Si](C)(C)C |
| InChI | InChI=1S/C13H24Si2/c1-14(2,3)12-10-8-7-9-11-13-15(4,5)6/h7-9H2,1-6H3 |
| InChIKey | JKTAJWQGGNQYMJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.51 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze trimethyl(7-trimethylsilylhepta-1,6-diynyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl(7-trimethylsilylhepta-1,6-diynyl)silane?
The IUPAC name of trimethyl(7-trimethylsilylhepta-1,6-diynyl)silane (CID 553168) is trimethyl(7-trimethylsilylhepta-1,6-diynyl)silane.
What is the SMILES notation for trimethyl(7-trimethylsilylhepta-1,6-diynyl)silane?
The canonical SMILES for trimethyl(7-trimethylsilylhepta-1,6-diynyl)silane is C[Si](C)(C)C#CCCCC#C[Si](C)(C)C.
What is the InChIKey of trimethyl(7-trimethylsilylhepta-1,6-diynyl)silane?
The InChIKey is JKTAJWQGGNQYMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24Si2/c1-14(2,3)12-10-8-7-9-11-13-15(4,5)6/h7-9H2,1-6H3.
What are the key properties of trimethyl(7-trimethylsilylhepta-1,6-diynyl)silane?
trimethyl(7-trimethylsilylhepta-1,6-diynyl)silane has a molecular weight of 236.51 g/mol, XLogP of 3.92, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl(7-trimethylsilylhepta-1,6-diynyl)silane is sourced from PubChem (CID 553168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).