About 2-(4-methylphenoxy)ethyl 2-phenylacetate
2-(4-methylphenoxy)ethyl 2-phenylacetate (PubChem CID 55319310) has the molecular formula C17H18O3
and a molecular weight of 270.33 g/mol. Its IUPAC name is 2-(4-methylphenoxy)ethyl 2-phenylacetate.
Molecular Properties
| Compound Name | 2-(4-methylphenoxy)ethyl 2-phenylacetate |
| PubChem CID | 55319310 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 2-(4-methylphenoxy)ethyl 2-phenylacetate |
| SMILES | Cc1ccc(OCCOC(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C17H18O3/c1-14-7-9-16(10-8-14)19-11-12-20-17(18)13-15-5-3-2-4-6-15/h2-10H,11-13H2,1H3 |
| InChIKey | PSVGXLVKFARVQG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methylphenoxy)ethyl 2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylphenoxy)ethyl 2-phenylacetate?
The IUPAC name of 2-(4-methylphenoxy)ethyl 2-phenylacetate (CID 55319310) is 2-(4-methylphenoxy)ethyl 2-phenylacetate.
What is the SMILES notation for 2-(4-methylphenoxy)ethyl 2-phenylacetate?
The canonical SMILES for 2-(4-methylphenoxy)ethyl 2-phenylacetate is Cc1ccc(OCCOC(=O)Cc2ccccc2)cc1.
What is the InChIKey of 2-(4-methylphenoxy)ethyl 2-phenylacetate?
The InChIKey is PSVGXLVKFARVQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O3/c1-14-7-9-16(10-8-14)19-11-12-20-17(18)13-15-5-3-2-4-6-15/h2-10H,11-13H2,1H3.
What are the key properties of 2-(4-methylphenoxy)ethyl 2-phenylacetate?
2-(4-methylphenoxy)ethyl 2-phenylacetate has a molecular weight of 270.33 g/mol, XLogP of 3.16, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylphenoxy)ethyl 2-phenylacetate is sourced from PubChem (CID 55319310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).