C21H22F3NO3 — CID 55320047
[1-(2-butan-2-ylanilino)-1-oxopropan-2-yl] 3-(trifluoromethyl)benzoate (PubChem CID 55320047) has the molecular formula C21H22F3NO3 and a molecular weight of 393.41 g/mol. Its IUPAC name is [1-(2-butan-2-ylanilino)-1-oxopropan-2-yl] 3-(trifluoromethyl)benzoate.
| Compound Name | [1-(2-butan-2-ylanilino)-1-oxopropan-2-yl] 3-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 55320047 |
| Molecular Formula | C21H22F3NO3 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | [1-(2-butan-2-ylanilino)-1-oxopropan-2-yl] 3-(trifluoromethyl)benzoate |
| SMILES | CCC(C)c1ccccc1NC(=O)C(C)OC(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H22F3NO3/c1-4-13(2)17-10-5-6-11-18(17)25-19(26)14(3)28-20(27)15-8-7-9-16(12-15)21(22,23)24/h5-14H,4H2,1-3H3,(H,25,26) |
| InChIKey | RDLVCVFWKJHTLK-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |